C18H12ClIN4O — CID 59851283
9-chloro-2-(3-iodoanilino)-5,7-dihydropyrimido[5,4-d][1]benzazepin-6-one (PubChem CID 59851283) has the molecular formula C18H12ClIN4O and a molecular weight of 462.68 g/mol. Its IUPAC name is 9-chloro-2-(3-iodoanilino)-5,7-dihydropyrimido[5,4-d][1]benzazepin-6-one.
| Compound Name | 9-chloro-2-(3-iodoanilino)-5,7-dihydropyrimido[5,4-d][1]benzazepin-6-one |
|---|---|
| PubChem CID | 59851283 |
| Molecular Formula | C18H12ClIN4O |
| Molecular Weight | 462.68 g/mol |
| Exact Mass | 461.97 |
| IUPAC Name | 9-chloro-2-(3-iodoanilino)-5,7-dihydropyrimido[5,4-d][1]benzazepin-6-one |
| SMILES | O=C1Cc2cnc(Nc3cccc(I)c3)nc2-c2ccc(Cl)cc2N1 |
| InChI | InChI=1S/C18H12ClIN4O/c19-11-4-5-14-15(7-11)23-16(25)6-10-9-21-18(24-17(10)14)22-13-3-1-2-12(20)8-13/h1-5,7-9H,6H2,(H,23,25)(H,21,22,24) |
| InChIKey | BFQSYSJGHDLJOC-UHFFFAOYSA-N |
| XLogP | 4.64 |
| TPSA | 66.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.68 |
| LogP ≤ 5 | 4.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|