C6H3Cl2N3 — CID 59851337
2-(4,6-dichloropyridazin-3-yl)acetonitrile (PubChem CID 59851337) has the molecular formula C6H3Cl2N3 and a molecular weight of 188.02 g/mol. Its IUPAC name is 2-(4,6-dichloropyridazin-3-yl)acetonitrile.
| Compound Name | 2-(4,6-dichloropyridazin-3-yl)acetonitrile |
|---|---|
| PubChem CID | 59851337 |
| Molecular Formula | C6H3Cl2N3 |
| Molecular Weight | 188.02 g/mol |
| Exact Mass | 186.97 |
| IUPAC Name | 2-(4,6-dichloropyridazin-3-yl)acetonitrile |
| SMILES | N#CCc1nnc(Cl)cc1Cl |
| InChI | InChI=1S/C6H3Cl2N3/c7-4-3-6(8)11-10-5(4)1-2-9/h3H,1H2 |
| InChIKey | MGPALOGTKQKDNU-UHFFFAOYSA-N |
| XLogP | 1.85 |
| TPSA | 49.57 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 188.02 |
| LogP ≤ 5 | 1.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |