C27H27N5O3S — CID 59851510
N-(1-ethynylcyclohexyl)-4-[(7-methyl-6-oxo-5H-pyrimido[5,4-d][1]benzazepin-2-yl)amino]benzenesulfonamide (PubChem CID 59851510) has the molecular formula C27H27N5O3S and a molecular weight of 501.61 g/mol. Its IUPAC name is N-(1-ethynylcyclohexyl)-4-[(7-methyl-6-oxo-5H-pyrimido[5,4-d][1]benzazepin-2-yl)amino]benzenesulfonamide.
| Compound Name | N-(1-ethynylcyclohexyl)-4-[(7-methyl-6-oxo-5H-pyrimido[5,4-d][1]benzazepin-2-yl)amino]benzenesulfonamide |
|---|---|
| PubChem CID | 59851510 |
| Molecular Formula | C27H27N5O3S |
| Molecular Weight | 501.61 g/mol |
| Exact Mass | 501.18 |
| IUPAC Name | N-(1-ethynylcyclohexyl)-4-[(7-methyl-6-oxo-5H-pyrimido[5,4-d][1]benzazepin-2-yl)amino]benzenesulfonamide |
| SMILES | C#CC1(NS(=O)(=O)c2ccc(Nc3ncc4c(n3)-c3ccccc3N(C)C(=O)C4)cc2)CCCCC1 |
| InChI | InChI=1S/C27H27N5O3S/c1-3-27(15-7-4-8-16-27)31-36(34,35)21-13-11-20(12-14-21)29-26-28-18-19-17-24(33)32(2)23-10-6-5-9-22(23)25(19)30-26/h1,5-6,9-14,18,31H,4,7-8,15-17H2,2H3,(H,28,29,30) |
| InChIKey | SYFDTYYNOBBKDZ-UHFFFAOYSA-N |
| XLogP | 4.02 |
| TPSA | 104.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 501.61 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|