C25H26ClN5O4 — CID 59851703
4-[(9-chloro-6-oxo-5,7-dihydropyrimido[5,4-d][1]benzazepin-2-yl)amino]-N-(2,2-diethoxyethyl)benzamide (PubChem CID 59851703) has the molecular formula C25H26ClN5O4 and a molecular weight of 495.97 g/mol. Its IUPAC name is 4-[(9-chloro-6-oxo-5,7-dihydropyrimido[5,4-d][1]benzazepin-2-yl)amino]-N-(2,2-diethoxyethyl)benzamide.
| Compound Name | 4-[(9-chloro-6-oxo-5,7-dihydropyrimido[5,4-d][1]benzazepin-2-yl)amino]-N-(2,2-diethoxyethyl)benzamide |
|---|---|
| PubChem CID | 59851703 |
| Molecular Formula | C25H26ClN5O4 |
| Molecular Weight | 495.97 g/mol |
| Exact Mass | 495.17 |
| IUPAC Name | 4-[(9-chloro-6-oxo-5,7-dihydropyrimido[5,4-d][1]benzazepin-2-yl)amino]-N-(2,2-diethoxyethyl)benzamide |
| SMILES | CCOC(CNC(=O)c1ccc(Nc2ncc3c(n2)-c2ccc(Cl)cc2NC(=O)C3)cc1)OCC |
| InChI | InChI=1S/C25H26ClN5O4/c1-3-34-22(35-4-2)14-27-24(33)15-5-8-18(9-6-15)29-25-28-13-16-11-21(32)30-20-12-17(26)7-10-19(20)23(16)31-25/h5-10,12-13,22H,3-4,11,14H2,1-2H3,(H,27,33)(H,30,32)(H,28,29,31) |
| InChIKey | FWWWNXAFJMUOPK-UHFFFAOYSA-N |
| XLogP | 4.16 |
| TPSA | 114.47 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 495.97 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|