About 3-(1-ethylimidazo[4,5-c]pyridin-2-yl)-5-(3-methylsulfonylphenyl)pyrazin-2-amine
3-(1-ethylimidazo[4,5-c]pyridin-2-yl)-5-(3-methylsulfonylphenyl)pyrazin-2-amine (PubChem CID 59852413) has the molecular formula C19H18N6O2S
and a molecular weight of 394.46 g/mol. Its IUPAC name is 3-(1-ethylimidazo[4,5-c]pyridin-2-yl)-5-(3-methylsulfonylphenyl)pyrazin-2-amine.
Molecular Properties
| Compound Name | 3-(1-ethylimidazo[4,5-c]pyridin-2-yl)-5-(3-methylsulfonylphenyl)pyrazin-2-amine |
| PubChem CID | 59852413 |
| Molecular Formula | C19H18N6O2S |
| Molecular Weight | 394.46 g/mol |
| Exact Mass | 394.12 |
| IUPAC Name | 3-(1-ethylimidazo[4,5-c]pyridin-2-yl)-5-(3-methylsulfonylphenyl)pyrazin-2-amine |
| SMILES | CCn1c(-c2nc(-c3cccc(S(C)(=O)=O)c3)cnc2N)nc2cnccc21 |
| InChI | InChI=1S/C19H18N6O2S/c1-3-25-16-7-8-21-10-15(16)24-19(25)17-18(20)22-11-14(23-17)12-5-4-6-13(9-12)28(2,26)27/h4-11H,3H2,1-2H3,(H2,20,22) |
| InChIKey | UXXSYJABFXVAHI-UHFFFAOYSA-N |
| XLogP | 2.56 |
| TPSA | 116.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 394.46 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
Analyze 3-(1-ethylimidazo[4,5-c]pyridin-2-yl)-5-(3-methylsulfonylphenyl)pyrazin-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(1-ethylimidazo[4,5-c]pyridin-2-yl)-5-(3-methylsulfonylphenyl)pyrazin-2-amine?
The IUPAC name of 3-(1-ethylimidazo[4,5-c]pyridin-2-yl)-5-(3-methylsulfonylphenyl)pyrazin-2-amine (CID 59852413) is 3-(1-ethylimidazo[4,5-c]pyridin-2-yl)-5-(3-methylsulfonylphenyl)pyrazin-2-amine.
What is the SMILES notation for 3-(1-ethylimidazo[4,5-c]pyridin-2-yl)-5-(3-methylsulfonylphenyl)pyrazin-2-amine?
The canonical SMILES for 3-(1-ethylimidazo[4,5-c]pyridin-2-yl)-5-(3-methylsulfonylphenyl)pyrazin-2-amine is CCn1c(-c2nc(-c3cccc(S(C)(=O)=O)c3)cnc2N)nc2cnccc21.
What is the InChIKey of 3-(1-ethylimidazo[4,5-c]pyridin-2-yl)-5-(3-methylsulfonylphenyl)pyrazin-2-amine?
The InChIKey is UXXSYJABFXVAHI-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H18N6O2S/c1-3-25-16-7-8-21-10-15(16)24-19(25)17-18(20)22-11-14(23-17)12-5-4-6-13(9-12)28(2,26)27/h4-11H,3H2,1-2H3,(H2,20,22).
What are the key properties of 3-(1-ethylimidazo[4,5-c]pyridin-2-yl)-5-(3-methylsulfonylphenyl)pyrazin-2-amine?
3-(1-ethylimidazo[4,5-c]pyridin-2-yl)-5-(3-methylsulfonylphenyl)pyrazin-2-amine has a molecular weight of 394.46 g/mol, XLogP of 2.56, 4 rotatable bonds, 1 hydrogen bond donors, and 8 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(1-ethylimidazo[4,5-c]pyridin-2-yl)-5-(3-methylsulfonylphenyl)pyrazin-2-amine is sourced from PubChem (CID 59852413), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).