C19H19FN4O2 — CID 59852668
3-[3-(2-butoxyphenyl)-4-fluorophenyl]-1H-1,2,4-triazole-5-carboxamide (PubChem CID 59852668) has the molecular formula C19H19FN4O2 and a molecular weight of 354.39 g/mol. Its IUPAC name is 3-[3-(2-butoxyphenyl)-4-fluorophenyl]-1H-1,2,4-triazole-5-carboxamide.
| Compound Name | 3-[3-(2-butoxyphenyl)-4-fluorophenyl]-1H-1,2,4-triazole-5-carboxamide |
|---|---|
| PubChem CID | 59852668 |
| Molecular Formula | C19H19FN4O2 |
| Molecular Weight | 354.39 g/mol |
| Exact Mass | 354.15 |
| IUPAC Name | 3-[3-(2-butoxyphenyl)-4-fluorophenyl]-1H-1,2,4-triazole-5-carboxamide |
| SMILES | CCCCOc1ccccc1-c1cc(-c2n[nH]c(C(N)=O)n2)ccc1F |
| InChI | InChI=1S/C19H19FN4O2/c1-2-3-10-26-16-7-5-4-6-13(16)14-11-12(8-9-15(14)20)18-22-19(17(21)25)24-23-18/h4-9,11H,2-3,10H2,1H3,(H2,21,25)(H,22,23,24) |
| InChIKey | URYWAECBGUPUSG-UHFFFAOYSA-N |
| XLogP | 3.56 |
| TPSA | 93.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.39 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|