C31H58F2O6Si — CID 59853180
7-[(1R,2R,3R,5S)-2-[3-[tert-butyl(dimethyl)silyl]oxy-4,4-difluorooctyl]-5-hydroxy-3-(oxan-2-yloxy)cyclopentyl]heptanoic acid (PubChem CID 59853180) has the molecular formula C31H58F2O6Si and a molecular weight of 592.88 g/mol. Its IUPAC name is 7-[(1R,2R,3R,5S)-2-[3-[tert-butyl(dimethyl)silyl]oxy-4,4-difluorooctyl]-5-hydroxy-3-(oxan-2-yloxy)cyclopentyl]heptanoic acid.
| Compound Name | 7-[(1R,2R,3R,5S)-2-[3-[tert-butyl(dimethyl)silyl]oxy-4,4-difluorooctyl]-5-hydroxy-3-(oxan-2-yloxy)cyclopentyl]heptanoic acid |
|---|---|
| PubChem CID | 59853180 |
| Molecular Formula | C31H58F2O6Si |
| Molecular Weight | 592.88 g/mol |
| Exact Mass | 592.40 |
| IUPAC Name | 7-[(1R,2R,3R,5S)-2-[3-[tert-butyl(dimethyl)silyl]oxy-4,4-difluorooctyl]-5-hydroxy-3-(oxan-2-yloxy)cyclopentyl]heptanoic acid |
| SMILES | CCCCC(F)(F)C(CC[C@@H]1[C@@H](CCCCCCC(=O)O)[C@@H](O)C[C@H]1OC1CCCCO1)O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C31H58F2O6Si/c1-7-8-20-31(32,33)27(39-40(5,6)30(2,3)4)19-18-24-23(15-11-9-10-12-16-28(35)36)25(34)22-26(24)38-29-17-13-14-21-37-29/h23-27,29,34H,7-22H2,1-6H3,(H,35,36)/t23-,24-,25+,26-,27?,29?/m1/s1 |
| InChIKey | WDDJIIGHZNOXTO-SZIFXSNDSA-N |
| XLogP | 8.32 |
| TPSA | 85.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 592.88 |
| LogP ≤ 5 | 8.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|