C23H37F3O9S — CID 59853278
1-O-[2-hydroxy-3-[(2-methyl-3-oxobutyl)sulfanylmethoxycarbonyloxy]propyl] 5-O-(3,3,3-trifluoropropyl) 4-ethyl-2,2,4-trimethylpentanedioate (PubChem CID 59853278) has the molecular formula C23H37F3O9S and a molecular weight of 546.60 g/mol. Its IUPAC name is 1-O-[2-hydroxy-3-[(2-methyl-3-oxobutyl)sulfanylmethoxycarbonyloxy]propyl] 5-O-(3,3,3-trifluoropropyl) 4-ethyl-2,2,4-trimethylpentanedioate.
| Compound Name | 1-O-[2-hydroxy-3-[(2-methyl-3-oxobutyl)sulfanylmethoxycarbonyloxy]propyl] 5-O-(3,3,3-trifluoropropyl) 4-ethyl-2,2,4-trimethylpentanedioate |
|---|---|
| PubChem CID | 59853278 |
| Molecular Formula | C23H37F3O9S |
| Molecular Weight | 546.60 g/mol |
| Exact Mass | 546.21 |
| IUPAC Name | 1-O-[2-hydroxy-3-[(2-methyl-3-oxobutyl)sulfanylmethoxycarbonyloxy]propyl] 5-O-(3,3,3-trifluoropropyl) 4-ethyl-2,2,4-trimethylpentanedioate |
| SMILES | CCC(C)(CC(C)(C)C(=O)OCC(O)COC(=O)OCSCC(C)C(C)=O)C(=O)OCCC(F)(F)F |
| InChI | InChI=1S/C23H37F3O9S/c1-7-22(6,19(30)32-9-8-23(24,25)26)13-21(4,5)18(29)33-10-17(28)11-34-20(31)35-14-36-12-15(2)16(3)27/h15,17,28H,7-14H2,1-6H3 |
| InChIKey | CHKNOJAQPRWDGI-UHFFFAOYSA-N |
| XLogP | 4.29 |
| TPSA | 125.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 546.60 |
| LogP ≤ 5 | 4.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|