C17H21ClNO6P — CID 59853456
N-[4-chloro-3-(2-dimethoxyphosphorylethoxymethyl)phenyl]-2-methylfuran-3-carboxamide (PubChem CID 59853456) has the molecular formula C17H21ClNO6P and a molecular weight of 401.78 g/mol. Its IUPAC name is N-[4-chloro-3-(2-dimethoxyphosphorylethoxymethyl)phenyl]-2-methylfuran-3-carboxamide.
| Compound Name | N-[4-chloro-3-(2-dimethoxyphosphorylethoxymethyl)phenyl]-2-methylfuran-3-carboxamide |
|---|---|
| PubChem CID | 59853456 |
| Molecular Formula | C17H21ClNO6P |
| Molecular Weight | 401.78 g/mol |
| Exact Mass | 401.08 |
| IUPAC Name | N-[4-chloro-3-(2-dimethoxyphosphorylethoxymethyl)phenyl]-2-methylfuran-3-carboxamide |
| SMILES | COP(=O)(CCOCc1cc(NC(=O)c2ccoc2C)ccc1Cl)OC |
| InChI | InChI=1S/C17H21ClNO6P/c1-12-15(6-7-25-12)17(20)19-14-4-5-16(18)13(10-14)11-24-8-9-26(21,22-2)23-3/h4-7,10H,8-9,11H2,1-3H3,(H,19,20) |
| InChIKey | ADYVOFCDICEOGW-UHFFFAOYSA-N |
| XLogP | 4.50 |
| TPSA | 87.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.78 |
| LogP ≤ 5 | 4.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|