C21H28O3 — CID 59853538
(10'R,13'S)-10',13'-dimethylspiro[1,3-dioxolane-2,17'-3,4,7,8,9,11,12,14-octahydrocyclopenta[a]phenanthrene]-3'-ol (PubChem CID 59853538) has the molecular formula C21H28O3 and a molecular weight of 328.45 g/mol. Its IUPAC name is (10'R,13'S)-10',13'-dimethylspiro[1,3-dioxolane-2,17'-3,4,7,8,9,11,12,14-octahydrocyclopenta[a]phenanthrene]-3'-ol.
| Compound Name | (10'R,13'S)-10',13'-dimethylspiro[1,3-dioxolane-2,17'-3,4,7,8,9,11,12,14-octahydrocyclopenta[a]phenanthrene]-3'-ol |
|---|---|
| PubChem CID | 59853538 |
| Molecular Formula | C21H28O3 |
| Molecular Weight | 328.45 g/mol |
| Exact Mass | 328.20 |
| IUPAC Name | (10'R,13'S)-10',13'-dimethylspiro[1,3-dioxolane-2,17'-3,4,7,8,9,11,12,14-octahydrocyclopenta[a]phenanthrene]-3'-ol |
| SMILES | C[C@]12C=CC(O)CC1=CCC1C2CC[C@@]2(C)C1C=CC21OCCO1 |
| InChI | InChI=1S/C21H28O3/c1-19-8-5-15(22)13-14(19)3-4-16-17(19)6-9-20(2)18(16)7-10-21(20)23-11-12-24-21/h3,5,7-8,10,15-18,22H,4,6,9,11-13H2,1-2H3/t15?,16?,17?,18?,19-,20-/m0/s1 |
| InChIKey | WKYVGESWCGUAKW-RZXUBOOQSA-N |
| XLogP | 3.61 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.45 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|