C11H14N2O6S2 — CID 59853590
N-[3-(2,2-dihydroxyethyl)-1,1-dioxo-4H-1λ6,4-benzothiazin-7-yl]methanesulfonamide (PubChem CID 59853590) has the molecular formula C11H14N2O6S2 and a molecular weight of 334.38 g/mol. Its IUPAC name is N-[3-(2,2-dihydroxyethyl)-1,1-dioxo-4H-1λ6,4-benzothiazin-7-yl]methanesulfonamide.
| Compound Name | N-[3-(2,2-dihydroxyethyl)-1,1-dioxo-4H-1λ6,4-benzothiazin-7-yl]methanesulfonamide |
|---|---|
| PubChem CID | 59853590 |
| Molecular Formula | C11H14N2O6S2 |
| Molecular Weight | 334.38 g/mol |
| Exact Mass | 334.03 |
| IUPAC Name | N-[3-(2,2-dihydroxyethyl)-1,1-dioxo-4H-1λ6,4-benzothiazin-7-yl]methanesulfonamide |
| SMILES | CS(=O)(=O)Nc1ccc2c(c1)S(=O)(=O)C=C(CC(O)O)N2 |
| InChI | InChI=1S/C11H14N2O6S2/c1-20(16,17)13-7-2-3-9-10(4-7)21(18,19)6-8(12-9)5-11(14)15/h2-4,6,11-15H,5H2,1H3 |
| InChIKey | CXLNRUMMNSTSSA-UHFFFAOYSA-N |
| XLogP | -0.20 |
| TPSA | 132.80 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.38 |
| LogP ≤ 5 | -0.20 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|