C26H32N2O3 — CID 59853920
tert-butyl N-[2-[methyl-[3-(2-tricyclo[9.4.0.03,8]pentadeca-1(15),3,5,7,9,11,13-heptaenyl)propyl]amino]-2-oxoethyl]carbamate (PubChem CID 59853920) has the molecular formula C26H32N2O3 and a molecular weight of 420.55 g/mol. Its IUPAC name is tert-butyl N-[2-[methyl-[3-(2-tricyclo[9.4.0.03,8]pentadeca-1(15),3,5,7,9,11,13-heptaenyl)propyl]amino]-2-oxoethyl]carbamate.
| Compound Name | tert-butyl N-[2-[methyl-[3-(2-tricyclo[9.4.0.03,8]pentadeca-1(15),3,5,7,9,11,13-heptaenyl)propyl]amino]-2-oxoethyl]carbamate |
|---|---|
| PubChem CID | 59853920 |
| Molecular Formula | C26H32N2O3 |
| Molecular Weight | 420.55 g/mol |
| Exact Mass | 420.24 |
| IUPAC Name | tert-butyl N-[2-[methyl-[3-(2-tricyclo[9.4.0.03,8]pentadeca-1(15),3,5,7,9,11,13-heptaenyl)propyl]amino]-2-oxoethyl]carbamate |
| SMILES | CN(CCCC1c2ccccc2C=Cc2ccccc21)C(=O)CNC(=O)OC(C)(C)C |
| InChI | InChI=1S/C26H32N2O3/c1-26(2,3)31-25(30)27-18-24(29)28(4)17-9-14-23-21-12-7-5-10-19(21)15-16-20-11-6-8-13-22(20)23/h5-8,10-13,15-16,23H,9,14,17-18H2,1-4H3,(H,27,30) |
| InChIKey | MOGZNZKCJADPEY-UHFFFAOYSA-N |
| XLogP | 5.07 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.55 |
| LogP ≤ 5 | 5.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|