C45H70N2O6 — CID 59854339
2-[8,8-dihexyl-15-(7-methyl-1,3-dioxo-4,7a-dihydro-3aH-4,7-epoxyisoindol-2-yl)pentadecyl]-7-methyl-4,7a-dihydro-3aH-4,7-epoxyisoindole-1,3-dione (PubChem CID 59854339) has the molecular formula C45H70N2O6 and a molecular weight of 735.06 g/mol. Its IUPAC name is 2-[8,8-dihexyl-15-(7-methyl-1,3-dioxo-4,7a-dihydro-3aH-4,7-epoxyisoindol-2-yl)pentadecyl]-7-methyl-4,7a-dihydro-3aH-4,7-epoxyisoindole-1,3-dione.
| Compound Name | 2-[8,8-dihexyl-15-(7-methyl-1,3-dioxo-4,7a-dihydro-3aH-4,7-epoxyisoindol-2-yl)pentadecyl]-7-methyl-4,7a-dihydro-3aH-4,7-epoxyisoindole-1,3-dione |
|---|---|
| PubChem CID | 59854339 |
| Molecular Formula | C45H70N2O6 |
| Molecular Weight | 735.06 g/mol |
| Exact Mass | 734.52 |
| IUPAC Name | 2-[8,8-dihexyl-15-(7-methyl-1,3-dioxo-4,7a-dihydro-3aH-4,7-epoxyisoindol-2-yl)pentadecyl]-7-methyl-4,7a-dihydro-3aH-4,7-epoxyisoindole-1,3-dione |
| SMILES | CCCCCCC(CCCCCC)(CCCCCCCN1C(=O)C2C3C=CC(C)(O3)C2C1=O)CCCCCCCN1C(=O)C2C3C=CC(C)(O3)C2C1=O |
| InChI | InChI=1S/C45H70N2O6/c1-5-7-9-17-25-45(26-18-10-8-6-2,27-19-13-11-15-21-31-46-39(48)35-33-23-29-43(3,52-33)37(35)41(46)50)28-20-14-12-16-22-32-47-40(49)36-34-24-30-44(4,53-34)38(36)42(47)51/h23-24,29-30,33-38H,5-22,25-28,31-32H2,1-4H3 |
| InChIKey | ZMVYSOQZXDEBEV-UHFFFAOYSA-N |
| XLogP | 9.25 |
| TPSA | 93.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 26 |
| Heavy Atoms | 53 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 735.06 |
| LogP ≤ 5 | 9.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|