C32H28N8O9S3 — CID 59854344
5-[(4-methyl-6-morpholin-4-yl-1,3,5-triazin-2-yl)amino]-2-[(E)-2-[4-(5-sulfinobenzo[e]benzotriazol-2-yl)-2-sulfophenyl]ethenyl]benzenesulfonic acid (PubChem CID 59854344) has the molecular formula C32H28N8O9S3 and a molecular weight of 764.82 g/mol. Its IUPAC name is 5-[(4-methyl-6-morpholin-4-yl-1,3,5-triazin-2-yl)amino]-2-[(E)-2-[4-(5-sulfinobenzo[e]benzotriazol-2-yl)-2-sulfophenyl]ethenyl]benzenesulfonic acid.
| Compound Name | 5-[(4-methyl-6-morpholin-4-yl-1,3,5-triazin-2-yl)amino]-2-[(E)-2-[4-(5-sulfinobenzo[e]benzotriazol-2-yl)-2-sulfophenyl]ethenyl]benzenesulfonic acid |
|---|---|
| PubChem CID | 59854344 |
| Molecular Formula | C32H28N8O9S3 |
| Molecular Weight | 764.82 g/mol |
| Exact Mass | 764.11 |
| IUPAC Name | 5-[(4-methyl-6-morpholin-4-yl-1,3,5-triazin-2-yl)amino]-2-[(E)-2-[4-(5-sulfinobenzo[e]benzotriazol-2-yl)-2-sulfophenyl]ethenyl]benzenesulfonic acid |
| SMILES | Cc1nc(Nc2ccc(/C=C/c3ccc(-n4nc5cc(S(=O)O)c6ccccc6c5n4)cc3S(=O)(=O)O)c(S(=O)(=O)O)c2)nc(N2CCOCC2)n1 |
| InChI | InChI=1S/C32H28N8O9S3/c1-19-33-31(36-32(34-19)39-12-14-49-15-13-39)35-22-10-8-20(28(16-22)51(43,44)45)6-7-21-9-11-23(17-29(21)52(46,47)48)40-37-26-18-27(50(41)42)24-4-2-3-5-25(24)30(26)38-40/h2-11,16-18H,12-15H2,1H3,(H,41,42)(H,43,44,45)(H,46,47,48)(H,33,34,35,36)/b7-6+ |
| InChIKey | OUMJOYQYXDDRDR-VOTSOKGWSA-N |
| XLogP | 3.89 |
| TPSA | 239.92 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 14 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 764.82 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 14 |
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'}, {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|