About 1-(3,5-dimethylpiperazin-1-yl)propan-2-one
1-(3,5-dimethylpiperazin-1-yl)propan-2-one (PubChem CID 59854564) has the molecular formula C9H18N2O
and a molecular weight of 170.26 g/mol. Its IUPAC name is 1-(3,5-dimethylpiperazin-1-yl)propan-2-one.
Molecular Properties
| Compound Name | 1-(3,5-dimethylpiperazin-1-yl)propan-2-one |
| PubChem CID | 59854564 |
| Molecular Formula | C9H18N2O |
| Molecular Weight | 170.26 g/mol |
| Exact Mass | 170.14 |
| IUPAC Name | 1-(3,5-dimethylpiperazin-1-yl)propan-2-one |
| SMILES | CC(=O)CN1CC(C)NC(C)C1 |
| InChI | InChI=1S/C9H18N2O/c1-7-4-11(6-9(3)12)5-8(2)10-7/h7-8,10H,4-6H2,1-3H3 |
| InChIKey | HDBCRWVGJONUCP-UHFFFAOYSA-N |
| XLogP | 0.26 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 170.26 |
| LogP ≤ 5 | 0.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 1-(3,5-dimethylpiperazin-1-yl)propan-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(3,5-dimethylpiperazin-1-yl)propan-2-one?
The IUPAC name of 1-(3,5-dimethylpiperazin-1-yl)propan-2-one (CID 59854564) is 1-(3,5-dimethylpiperazin-1-yl)propan-2-one.
What is the SMILES notation for 1-(3,5-dimethylpiperazin-1-yl)propan-2-one?
The canonical SMILES for 1-(3,5-dimethylpiperazin-1-yl)propan-2-one is CC(=O)CN1CC(C)NC(C)C1.
What is the InChIKey of 1-(3,5-dimethylpiperazin-1-yl)propan-2-one?
The InChIKey is HDBCRWVGJONUCP-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H18N2O/c1-7-4-11(6-9(3)12)5-8(2)10-7/h7-8,10H,4-6H2,1-3H3.
What are the key properties of 1-(3,5-dimethylpiperazin-1-yl)propan-2-one?
1-(3,5-dimethylpiperazin-1-yl)propan-2-one has a molecular weight of 170.26 g/mol, XLogP of 0.26, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(3,5-dimethylpiperazin-1-yl)propan-2-one is sourced from PubChem (CID 59854564), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).