About 4-(4,4-difluoropiperidin-1-yl)-3,3-dimethylbutan-2-one
4-(4,4-difluoropiperidin-1-yl)-3,3-dimethylbutan-2-one (PubChem CID 59854574) has the molecular formula C11H19F2NO
and a molecular weight of 219.27 g/mol. Its IUPAC name is 4-(4,4-difluoropiperidin-1-yl)-3,3-dimethylbutan-2-one.
Molecular Properties
| Compound Name | 4-(4,4-difluoropiperidin-1-yl)-3,3-dimethylbutan-2-one |
| PubChem CID | 59854574 |
| Molecular Formula | C11H19F2NO |
| Molecular Weight | 219.27 g/mol |
| Exact Mass | 219.14 |
| IUPAC Name | 4-(4,4-difluoropiperidin-1-yl)-3,3-dimethylbutan-2-one |
| SMILES | CC(=O)C(C)(C)CN1CCC(F)(F)CC1 |
| InChI | InChI=1S/C11H19F2NO/c1-9(15)10(2,3)8-14-6-4-11(12,13)5-7-14/h4-8H2,1-3H3 |
| InChIKey | VIQWBABTDWUBHM-UHFFFAOYSA-N |
| XLogP | 2.33 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 219.27 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 4-(4,4-difluoropiperidin-1-yl)-3,3-dimethylbutan-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(4,4-difluoropiperidin-1-yl)-3,3-dimethylbutan-2-one?
The IUPAC name of 4-(4,4-difluoropiperidin-1-yl)-3,3-dimethylbutan-2-one (CID 59854574) is 4-(4,4-difluoropiperidin-1-yl)-3,3-dimethylbutan-2-one.
What is the SMILES notation for 4-(4,4-difluoropiperidin-1-yl)-3,3-dimethylbutan-2-one?
The canonical SMILES for 4-(4,4-difluoropiperidin-1-yl)-3,3-dimethylbutan-2-one is CC(=O)C(C)(C)CN1CCC(F)(F)CC1.
What is the InChIKey of 4-(4,4-difluoropiperidin-1-yl)-3,3-dimethylbutan-2-one?
The InChIKey is VIQWBABTDWUBHM-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H19F2NO/c1-9(15)10(2,3)8-14-6-4-11(12,13)5-7-14/h4-8H2,1-3H3.
What are the key properties of 4-(4,4-difluoropiperidin-1-yl)-3,3-dimethylbutan-2-one?
4-(4,4-difluoropiperidin-1-yl)-3,3-dimethylbutan-2-one has a molecular weight of 219.27 g/mol, XLogP of 2.33, 3 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(4,4-difluoropiperidin-1-yl)-3,3-dimethylbutan-2-one is sourced from PubChem (CID 59854574), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).