C24H25Cl3N2O5S — CID 59854700
7,7-dichloro-2-(2-chloro-3,4,5-trimethoxyphenyl)-3-(2-methylbutyl)-5,6-dihydro-[1]benzothiolo[2,3-d]pyrimidine-4,8-dione (PubChem CID 59854700) has the molecular formula C24H25Cl3N2O5S and a molecular weight of 559.90 g/mol. Its IUPAC name is 7,7-dichloro-2-(2-chloro-3,4,5-trimethoxyphenyl)-3-(2-methylbutyl)-5,6-dihydro-[1]benzothiolo[2,3-d]pyrimidine-4,8-dione.
| Compound Name | 7,7-dichloro-2-(2-chloro-3,4,5-trimethoxyphenyl)-3-(2-methylbutyl)-5,6-dihydro-[1]benzothiolo[2,3-d]pyrimidine-4,8-dione |
|---|---|
| PubChem CID | 59854700 |
| Molecular Formula | C24H25Cl3N2O5S |
| Molecular Weight | 559.90 g/mol |
| Exact Mass | 558.05 |
| IUPAC Name | 7,7-dichloro-2-(2-chloro-3,4,5-trimethoxyphenyl)-3-(2-methylbutyl)-5,6-dihydro-[1]benzothiolo[2,3-d]pyrimidine-4,8-dione |
| SMILES | CCC(C)Cn1c(-c2cc(OC)c(OC)c(OC)c2Cl)nc2sc3c(c2c1=O)CCC(Cl)(Cl)C3=O |
| InChI | InChI=1S/C24H25Cl3N2O5S/c1-6-11(2)10-29-21(13-9-14(32-3)17(33-4)18(34-5)16(13)25)28-22-15(23(29)31)12-7-8-24(26,27)20(30)19(12)35-22/h9,11H,6-8,10H2,1-5H3 |
| InChIKey | CWHQXXIBCKCPOD-UHFFFAOYSA-N |
| XLogP | 6.15 |
| TPSA | 79.65 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 559.90 |
| LogP ≤ 5 | 6.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|