C24H8F8 — CID 59855591
1,2,3,4,9,10,11,12-octafluorotetraphenylene (PubChem CID 59855591) has the molecular formula C24H8F8 and a molecular weight of 448.31 g/mol. Its IUPAC name is 1,2,3,4,9,10,11,12-octafluorotetraphenylene.
| Compound Name | 1,2,3,4,9,10,11,12-octafluorotetraphenylene |
|---|---|
| PubChem CID | 59855591 |
| Molecular Formula | C24H8F8 |
| Molecular Weight | 448.31 g/mol |
| Exact Mass | 448.05 |
| IUPAC Name | 1,2,3,4,9,10,11,12-octafluorotetraphenylene |
| SMILES | Fc1c(F)c(F)c2c(c1F)-c1ccccc1-c1c(F)c(F)c(F)c(F)c1-c1ccccc1-2 |
| InChI | InChI=1S/C24H8F8/c25-17-13-9-5-1-2-6-10(9)14-16(20(28)24(32)22(30)18(14)26)12-8-4-3-7-11(12)15(13)19(27)23(31)21(17)29/h1-8H/b13-9+,14-10+,15-11+,16-12+ |
| InChIKey | QTJOXTHDPVCBDV-KUWVSJDVSA-N |
| XLogP | 7.78 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.31 |
| LogP ≤ 5 | 7.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|