About CID 59855750
CID 59855750 (PubChem CID 59855750) has the molecular formula C10H14BN2Y-
and a molecular weight of 261.95 g/mol.
Molecular Properties
| Compound Name | CID 59855750 |
| PubChem CID | 59855750 |
| Molecular Formula | C10H14BN2Y- |
| Molecular Weight | 261.95 g/mol |
| Exact Mass | 262.03 |
| IUPAC Name | — |
| SMILES | [B]N(CC)NCCc1cc[c-]cc1.[Y] |
| InChI | InChI=1S/C10H14BN2.Y/c1-2-13(11)12-9-8-10-6-4-3-5-7-10;/h4-7,12H,2,8-9H2,1H3;/q-1; |
| InChIKey | JXUPPUQXIOELDW-UHFFFAOYSA-N |
| XLogP | 0.94 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 261.95 |
| LogP ≤ 5 | 0.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze CID 59855750 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 59855750?
The IUPAC name of CID 59855750 (CID 59855750) is not available.
What is the SMILES notation for CID 59855750?
The canonical SMILES for CID 59855750 is [B]N(CC)NCCc1cc[c-]cc1.[Y].
What is the InChIKey of CID 59855750?
The InChIKey is JXUPPUQXIOELDW-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H14BN2.Y/c1-2-13(11)12-9-8-10-6-4-3-5-7-10;/h4-7,12H,2,8-9H2,1H3;/q-1;.
What are the key properties of CID 59855750?
CID 59855750 has a molecular weight of 261.95 g/mol, XLogP of 0.94, 5 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for CID 59855750 is sourced from PubChem (CID 59855750), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).