C32H34B2Br2N2O4+2 — CID 59856367
1-[[3-(bromomethyl)-5-(1,3,2-dioxaborinan-2-yl)phenyl]methyl]-4-[1-[[3-(bromomethyl)-5-(1,3,2-dioxaborinan-2-yl)phenyl]methyl]pyridin-1-ium-4-yl]pyridin-1-ium (PubChem CID 59856367) has the molecular formula C32H34B2Br2N2O4+2 and a molecular weight of 692.07 g/mol. Its IUPAC name is 1-[[3-(bromomethyl)-5-(1,3,2-dioxaborinan-2-yl)phenyl]methyl]-4-[1-[[3-(bromomethyl)-5-(1,3,2-dioxaborinan-2-yl)phenyl]methyl]pyridin-1-ium-4-yl]pyridin-1-ium.
| Compound Name | 1-[[3-(bromomethyl)-5-(1,3,2-dioxaborinan-2-yl)phenyl]methyl]-4-[1-[[3-(bromomethyl)-5-(1,3,2-dioxaborinan-2-yl)phenyl]methyl]pyridin-1-ium-4-yl]pyridin-1-ium |
|---|---|
| PubChem CID | 59856367 |
| Molecular Formula | C32H34B2Br2N2O4+2 |
| Molecular Weight | 692.07 g/mol |
| Exact Mass | 690.11 |
| IUPAC Name | 1-[[3-(bromomethyl)-5-(1,3,2-dioxaborinan-2-yl)phenyl]methyl]-4-[1-[[3-(bromomethyl)-5-(1,3,2-dioxaborinan-2-yl)phenyl]methyl]pyridin-1-ium-4-yl]pyridin-1-ium |
| SMILES | BrCc1cc(C[n+]2ccc(-c3cc[n+](Cc4cc(CBr)cc(B5OCCCO5)c4)cc3)cc2)cc(B2OCCCO2)c1 |
| InChI | InChI=1S/C32H34B2Br2N2O4/c35-21-25-15-27(19-31(17-25)33-39-11-1-12-40-33)23-37-7-3-29(4-8-37)30-5-9-38(10-6-30)24-28-16-26(22-36)18-32(20-28)34-41-13-2-14-42-34/h3-10,15-20H,1-2,11-14,21-24H2/q+2 |
| InChIKey | GAZWPQLCCZADCX-UHFFFAOYSA-N |
| XLogP | 4.08 |
| TPSA | 44.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 692.07 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|