About 1-[2-(4-hydroxybutyl)-1,3-dithian-2-yl]pentan-3-ol
1-[2-(4-hydroxybutyl)-1,3-dithian-2-yl]pentan-3-ol (PubChem CID 598587) has the molecular formula C13H26O2S2
and a molecular weight of 278.48 g/mol. Its IUPAC name is 1-[2-(4-hydroxybutyl)-1,3-dithian-2-yl]pentan-3-ol.
Molecular Properties
| Compound Name | 1-[2-(4-hydroxybutyl)-1,3-dithian-2-yl]pentan-3-ol |
| PubChem CID | 598587 |
| Molecular Formula | C13H26O2S2 |
| Molecular Weight | 278.48 g/mol |
| Exact Mass | 278.14 |
| IUPAC Name | 1-[2-(4-hydroxybutyl)-1,3-dithian-2-yl]pentan-3-ol |
| SMILES | CCC(O)CCC1(CCCCO)SCCCS1 |
| InChI | InChI=1S/C13H26O2S2/c1-2-12(15)6-8-13(7-3-4-9-14)16-10-5-11-17-13/h12,14-15H,2-11H2,1H3 |
| InChIKey | FRMUMOMACXTSAW-UHFFFAOYSA-N |
| XLogP | 3.27 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 278.48 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 1-[2-(4-hydroxybutyl)-1,3-dithian-2-yl]pentan-3-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[2-(4-hydroxybutyl)-1,3-dithian-2-yl]pentan-3-ol?
The IUPAC name of 1-[2-(4-hydroxybutyl)-1,3-dithian-2-yl]pentan-3-ol (CID 598587) is 1-[2-(4-hydroxybutyl)-1,3-dithian-2-yl]pentan-3-ol.
What is the SMILES notation for 1-[2-(4-hydroxybutyl)-1,3-dithian-2-yl]pentan-3-ol?
The canonical SMILES for 1-[2-(4-hydroxybutyl)-1,3-dithian-2-yl]pentan-3-ol is CCC(O)CCC1(CCCCO)SCCCS1.
What is the InChIKey of 1-[2-(4-hydroxybutyl)-1,3-dithian-2-yl]pentan-3-ol?
The InChIKey is FRMUMOMACXTSAW-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H26O2S2/c1-2-12(15)6-8-13(7-3-4-9-14)16-10-5-11-17-13/h12,14-15H,2-11H2,1H3.
What are the key properties of 1-[2-(4-hydroxybutyl)-1,3-dithian-2-yl]pentan-3-ol?
1-[2-(4-hydroxybutyl)-1,3-dithian-2-yl]pentan-3-ol has a molecular weight of 278.48 g/mol, XLogP of 3.27, 8 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[2-(4-hydroxybutyl)-1,3-dithian-2-yl]pentan-3-ol is sourced from PubChem (CID 598587), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).