C29H33BrN2 — CID 59858723
N-[2-bromo-4-(2,2-dimethylpropyl)phenyl]-2-(2,2-dimethylpropyl)phenanthridin-6-amine (PubChem CID 59858723) has the molecular formula C29H33BrN2 and a molecular weight of 489.50 g/mol. Its IUPAC name is N-[2-bromo-4-(2,2-dimethylpropyl)phenyl]-2-(2,2-dimethylpropyl)phenanthridin-6-amine.
| Compound Name | N-[2-bromo-4-(2,2-dimethylpropyl)phenyl]-2-(2,2-dimethylpropyl)phenanthridin-6-amine |
|---|---|
| PubChem CID | 59858723 |
| Molecular Formula | C29H33BrN2 |
| Molecular Weight | 489.50 g/mol |
| Exact Mass | 488.18 |
| IUPAC Name | N-[2-bromo-4-(2,2-dimethylpropyl)phenyl]-2-(2,2-dimethylpropyl)phenanthridin-6-amine |
| SMILES | CC(C)(C)Cc1ccc(Nc2nc3ccc(CC(C)(C)C)cc3c3ccccc23)c(Br)c1 |
| InChI | InChI=1S/C29H33BrN2/c1-28(2,3)17-19-11-13-25-23(15-19)21-9-7-8-10-22(21)27(31-25)32-26-14-12-20(16-24(26)30)18-29(4,5)6/h7-16H,17-18H2,1-6H3,(H,31,32) |
| InChIKey | HSBKCQLHDJWGQX-UHFFFAOYSA-N |
| XLogP | 9.07 |
| TPSA | 24.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 489.50 |
| LogP ≤ 5 | 9.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|