C37H20F12O6S2 — CID 59859031
[6-[4-[1,1,1,3,3,3-hexafluoro-2-[4-[6-(trifluoromethylsulfonyloxy)naphthalen-2-yl]phenyl]propan-2-yl]phenyl]naphthalen-2-yl] trifluoromethanesulfonate (PubChem CID 59859031) has the molecular formula C37H20F12O6S2 and a molecular weight of 852.67 g/mol. Its IUPAC name is [6-[4-[1,1,1,3,3,3-hexafluoro-2-[4-[6-(trifluoromethylsulfonyloxy)naphthalen-2-yl]phenyl]propan-2-yl]phenyl]naphthalen-2-yl] trifluoromethanesulfonate.
| Compound Name | [6-[4-[1,1,1,3,3,3-hexafluoro-2-[4-[6-(trifluoromethylsulfonyloxy)naphthalen-2-yl]phenyl]propan-2-yl]phenyl]naphthalen-2-yl] trifluoromethanesulfonate |
|---|---|
| PubChem CID | 59859031 |
| Molecular Formula | C37H20F12O6S2 |
| Molecular Weight | 852.67 g/mol |
| Exact Mass | 852.05 |
| IUPAC Name | [6-[4-[1,1,1,3,3,3-hexafluoro-2-[4-[6-(trifluoromethylsulfonyloxy)naphthalen-2-yl]phenyl]propan-2-yl]phenyl]naphthalen-2-yl] trifluoromethanesulfonate |
| SMILES | O=S(=O)(Oc1ccc2cc(-c3ccc(C(c4ccc(-c5ccc6cc(OS(=O)(=O)C(F)(F)F)ccc6c5)cc4)(C(F)(F)F)C(F)(F)F)cc3)ccc2c1)C(F)(F)F |
| InChI | InChI=1S/C37H20F12O6S2/c38-34(39,40)33(35(41,42)43,29-11-5-21(6-12-29)23-1-3-27-19-31(15-9-25(27)17-23)54-56(50,51)36(44,45)46)30-13-7-22(8-14-30)24-2-4-28-20-32(16-10-26(28)18-24)55-57(52,53)37(47,48)49/h1-20H |
| InChIKey | SGAUMSGQSJENJU-UHFFFAOYSA-N |
| XLogP | 11.19 |
| TPSA | 86.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 57 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 852.67 |
| LogP ≤ 5 | 11.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|