C16H27NO6 — CID 59859133
1-[4,4-bis(3-methoxypropoxy)butyl]pyrrole-2,5-dione (PubChem CID 59859133) has the molecular formula C16H27NO6 and a molecular weight of 329.39 g/mol. Its IUPAC name is 1-[4,4-bis(3-methoxypropoxy)butyl]pyrrole-2,5-dione.
| Compound Name | 1-[4,4-bis(3-methoxypropoxy)butyl]pyrrole-2,5-dione |
|---|---|
| PubChem CID | 59859133 |
| Molecular Formula | C16H27NO6 |
| Molecular Weight | 329.39 g/mol |
| Exact Mass | 329.18 |
| IUPAC Name | 1-[4,4-bis(3-methoxypropoxy)butyl]pyrrole-2,5-dione |
| SMILES | COCCCOC(CCCN1C(=O)C=CC1=O)OCCCOC |
| InChI | InChI=1S/C16H27NO6/c1-20-10-4-12-22-16(23-13-5-11-21-2)6-3-9-17-14(18)7-8-15(17)19/h7-8,16H,3-6,9-13H2,1-2H3 |
| InChIKey | POFUTSIDFHGSJD-UHFFFAOYSA-N |
| XLogP | 1.12 |
| TPSA | 74.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.39 |
| LogP ≤ 5 | 1.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|