C17H27NO9 — CID 59859138
4-[4,4-bis(2-acetyloxyethoxy)piperidin-1-yl]-4-oxobutanoic acid (PubChem CID 59859138) has the molecular formula C17H27NO9 and a molecular weight of 389.40 g/mol. Its IUPAC name is 4-[4,4-bis(2-acetyloxyethoxy)piperidin-1-yl]-4-oxobutanoic acid.
| Compound Name | 4-[4,4-bis(2-acetyloxyethoxy)piperidin-1-yl]-4-oxobutanoic acid |
|---|---|
| PubChem CID | 59859138 |
| Molecular Formula | C17H27NO9 |
| Molecular Weight | 389.40 g/mol |
| Exact Mass | 389.17 |
| IUPAC Name | 4-[4,4-bis(2-acetyloxyethoxy)piperidin-1-yl]-4-oxobutanoic acid |
| SMILES | CC(=O)OCCOC1(OCCOC(C)=O)CCN(C(=O)CCC(=O)O)CC1 |
| InChI | InChI=1S/C17H27NO9/c1-13(19)24-9-11-26-17(27-12-10-25-14(2)20)5-7-18(8-6-17)15(21)3-4-16(22)23/h3-12H2,1-2H3,(H,22,23) |
| InChIKey | XPRFVVDLXPRFPQ-UHFFFAOYSA-N |
| XLogP | 0.33 |
| TPSA | 128.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.40 |
| LogP ≤ 5 | 0.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|