C21H31N — CID 59859287
(3E,5E,7E,9E)-N,3,7-trimethyl-9-(2,6,6-trimethylcyclohex-2-en-1-ylidene)nona-3,5,7-trien-1-imine (PubChem CID 59859287) has the molecular formula C21H31N and a molecular weight of 297.49 g/mol. Its IUPAC name is (3E,5E,7E,9E)-N,3,7-trimethyl-9-(2,6,6-trimethylcyclohex-2-en-1-ylidene)nona-3,5,7-trien-1-imine.
| Compound Name | (3E,5E,7E,9E)-N,3,7-trimethyl-9-(2,6,6-trimethylcyclohex-2-en-1-ylidene)nona-3,5,7-trien-1-imine |
|---|---|
| PubChem CID | 59859287 |
| Molecular Formula | C21H31N |
| Molecular Weight | 297.49 g/mol |
| Exact Mass | 297.25 |
| IUPAC Name | (3E,5E,7E,9E)-N,3,7-trimethyl-9-(2,6,6-trimethylcyclohex-2-en-1-ylidene)nona-3,5,7-trien-1-imine |
| SMILES | C/N=C/C/C(C)=C/C=C/C(C)=C/C=C1/C(C)=CCCC1(C)C |
| InChI | InChI=1S/C21H31N/c1-17(9-7-10-18(2)14-16-22-6)12-13-20-19(3)11-8-15-21(20,4)5/h7,9-13,16H,8,14-15H2,1-6H3/b9-7+,17-12+,18-10+,20-13-,22-16+ |
| InChIKey | CDCCQRJBFQWZAS-HUQZGLAVSA-N |
| XLogP | 6.22 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.49 |
| LogP ≤ 5 | 6.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|