C26H14F7N — CID 59859338
5-phenyl-2-[5,6,7,8-tetrafluoro-9-methyl-9-(trifluoromethyl)fluoren-2-yl]pyridine (PubChem CID 59859338) has the molecular formula C26H14F7N and a molecular weight of 473.39 g/mol. Its IUPAC name is 5-phenyl-2-[5,6,7,8-tetrafluoro-9-methyl-9-(trifluoromethyl)fluoren-2-yl]pyridine.
| Compound Name | 5-phenyl-2-[5,6,7,8-tetrafluoro-9-methyl-9-(trifluoromethyl)fluoren-2-yl]pyridine |
|---|---|
| PubChem CID | 59859338 |
| Molecular Formula | C26H14F7N |
| Molecular Weight | 473.39 g/mol |
| Exact Mass | 473.10 |
| IUPAC Name | 5-phenyl-2-[5,6,7,8-tetrafluoro-9-methyl-9-(trifluoromethyl)fluoren-2-yl]pyridine |
| SMILES | CC1(C(F)(F)F)c2cc(-c3ccc(-c4ccccc4)cn3)ccc2-c2c(F)c(F)c(F)c(F)c21 |
| InChI | InChI=1S/C26H14F7N/c1-25(26(31,32)33)17-11-14(18-10-8-15(12-34-18)13-5-3-2-4-6-13)7-9-16(17)19-20(25)22(28)24(30)23(29)21(19)27/h2-12H,1H3 |
| InChIKey | DMSMIGBKCDHSOT-UHFFFAOYSA-N |
| XLogP | 7.82 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.39 |
| LogP ≤ 5 | 7.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|