C24H13F5IrN- — CID 59859380
2-[6,8-difluoro-9-methyl-9-(trifluoromethyl)-3H-fluoren-3-id-2-yl]quinoline;iridium (PubChem CID 59859380) has the molecular formula C24H13F5IrN- and a molecular weight of 602.58 g/mol. Its IUPAC name is 2-[6,8-difluoro-9-methyl-9-(trifluoromethyl)-3H-fluoren-3-id-2-yl]quinoline;iridium.
| Compound Name | 2-[6,8-difluoro-9-methyl-9-(trifluoromethyl)-3H-fluoren-3-id-2-yl]quinoline;iridium |
|---|---|
| PubChem CID | 59859380 |
| Molecular Formula | C24H13F5IrN- |
| Molecular Weight | 602.58 g/mol |
| Exact Mass | 603.06 |
| IUPAC Name | 2-[6,8-difluoro-9-methyl-9-(trifluoromethyl)-3H-fluoren-3-id-2-yl]quinoline;iridium |
| SMILES | CC1(C(F)(F)F)c2cc(-c3ccc4ccccc4n3)[c-]cc2-c2cc(F)cc(F)c21.[Ir] |
| InChI | InChI=1S/C24H13F5N.Ir/c1-23(24(27,28)29)18-10-14(21-9-7-13-4-2-3-5-20(13)30-21)6-8-16(18)17-11-15(25)12-19(26)22(17)23;/h2-5,7-12H,1H3;/q-1; |
| InChIKey | WMIPDGKGZHNVFE-UHFFFAOYSA-N |
| XLogP | 6.83 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 31 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 602.58 |
| LogP ≤ 5 | 6.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|