C26H16F6NPt- — CID 59859390
2-[9,9-bis(trifluoromethyl)-3H-fluoren-3-id-2-yl]-4-ethylquinoline;platinum (PubChem CID 59859390) has the molecular formula C26H16F6NPt- and a molecular weight of 651.49 g/mol. Its IUPAC name is 2-[9,9-bis(trifluoromethyl)-3H-fluoren-3-id-2-yl]-4-ethylquinoline;platinum.
| Compound Name | 2-[9,9-bis(trifluoromethyl)-3H-fluoren-3-id-2-yl]-4-ethylquinoline;platinum |
|---|---|
| PubChem CID | 59859390 |
| Molecular Formula | C26H16F6NPt- |
| Molecular Weight | 651.49 g/mol |
| Exact Mass | 651.08 |
| IUPAC Name | 2-[9,9-bis(trifluoromethyl)-3H-fluoren-3-id-2-yl]-4-ethylquinoline;platinum |
| SMILES | CCc1cc(-c2[c-]cc3c(c2)C(C(F)(F)F)(C(F)(F)F)c2ccccc2-3)nc2ccccc12.[Pt] |
| InChI | InChI=1S/C26H16F6N.Pt/c1-2-15-14-23(33-22-10-6-4-7-17(15)22)16-11-12-19-18-8-3-5-9-20(18)24(21(19)13-16,25(27,28)29)26(30,31)32;/h3-10,12-14H,2H2,1H3;/q-1; |
| InChIKey | RAVKWPYQJIHTRP-UHFFFAOYSA-N |
| XLogP | 7.65 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 651.49 |
| LogP ≤ 5 | 7.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|