About [(5R)-5-ethyl-3-methyl-2,5-dihydrofuran-2-yl]methanamine
[(5R)-5-ethyl-3-methyl-2,5-dihydrofuran-2-yl]methanamine (PubChem CID 59859713) has the molecular formula C8H15NO
and a molecular weight of 141.21 g/mol. Its IUPAC name is [(5R)-5-ethyl-3-methyl-2,5-dihydrofuran-2-yl]methanamine.
Molecular Properties
| Compound Name | [(5R)-5-ethyl-3-methyl-2,5-dihydrofuran-2-yl]methanamine |
| PubChem CID | 59859713 |
| Molecular Formula | C8H15NO |
| Molecular Weight | 141.21 g/mol |
| Exact Mass | 141.12 |
| IUPAC Name | [(5R)-5-ethyl-3-methyl-2,5-dihydrofuran-2-yl]methanamine |
| SMILES | CC[C@@H]1C=C(C)C(CN)O1 |
| InChI | InChI=1S/C8H15NO/c1-3-7-4-6(2)8(5-9)10-7/h4,7-8H,3,5,9H2,1-2H3/t7-,8?/m1/s1 |
| InChIKey | DVUHOTYSZAGGOW-GVHYBUMESA-N |
| XLogP | 1.07 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 141.21 |
| LogP ≤ 5 | 1.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze [(5R)-5-ethyl-3-methyl-2,5-dihydrofuran-2-yl]methanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(5R)-5-ethyl-3-methyl-2,5-dihydrofuran-2-yl]methanamine?
The IUPAC name of [(5R)-5-ethyl-3-methyl-2,5-dihydrofuran-2-yl]methanamine (CID 59859713) is [(5R)-5-ethyl-3-methyl-2,5-dihydrofuran-2-yl]methanamine.
What is the SMILES notation for [(5R)-5-ethyl-3-methyl-2,5-dihydrofuran-2-yl]methanamine?
The canonical SMILES for [(5R)-5-ethyl-3-methyl-2,5-dihydrofuran-2-yl]methanamine is CC[C@@H]1C=C(C)C(CN)O1.
What is the InChIKey of [(5R)-5-ethyl-3-methyl-2,5-dihydrofuran-2-yl]methanamine?
The InChIKey is DVUHOTYSZAGGOW-GVHYBUMESA-N. The full InChI is InChI=1S/C8H15NO/c1-3-7-4-6(2)8(5-9)10-7/h4,7-8H,3,5,9H2,1-2H3/t7-,8?/m1/s1.
What are the key properties of [(5R)-5-ethyl-3-methyl-2,5-dihydrofuran-2-yl]methanamine?
[(5R)-5-ethyl-3-methyl-2,5-dihydrofuran-2-yl]methanamine has a molecular weight of 141.21 g/mol, XLogP of 1.07, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for [(5R)-5-ethyl-3-methyl-2,5-dihydrofuran-2-yl]methanamine is sourced from PubChem (CID 59859713), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).