About 4-amino-1-[(2R,5R)-5-methyloxolan-2-yl]pyrimidin-2-one
4-amino-1-[(2R,5R)-5-methyloxolan-2-yl]pyrimidin-2-one (PubChem CID 59859735) has the molecular formula C9H13N3O2
and a molecular weight of 195.22 g/mol. Its IUPAC name is 4-amino-1-[(2R,5R)-5-methyloxolan-2-yl]pyrimidin-2-one.
Molecular Properties
| Compound Name | 4-amino-1-[(2R,5R)-5-methyloxolan-2-yl]pyrimidin-2-one |
| PubChem CID | 59859735 |
| Molecular Formula | C9H13N3O2 |
| Molecular Weight | 195.22 g/mol |
| Exact Mass | 195.10 |
| IUPAC Name | 4-amino-1-[(2R,5R)-5-methyloxolan-2-yl]pyrimidin-2-one |
| SMILES | C[C@@H]1CC[C@H](n2ccc(N)nc2=O)O1 |
| InChI | InChI=1S/C9H13N3O2/c1-6-2-3-8(14-6)12-5-4-7(10)11-9(12)13/h4-6,8H,2-3H2,1H3,(H2,10,11,13)/t6-,8-/m1/s1 |
| InChIKey | LUQDPHKLUKPHKK-HTRCEHHLSA-N |
| XLogP | 0.52 |
| TPSA | 70.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 195.22 |
| LogP ≤ 5 | 0.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 4-amino-1-[(2R,5R)-5-methyloxolan-2-yl]pyrimidin-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-amino-1-[(2R,5R)-5-methyloxolan-2-yl]pyrimidin-2-one?
The IUPAC name of 4-amino-1-[(2R,5R)-5-methyloxolan-2-yl]pyrimidin-2-one (CID 59859735) is 4-amino-1-[(2R,5R)-5-methyloxolan-2-yl]pyrimidin-2-one.
What is the SMILES notation for 4-amino-1-[(2R,5R)-5-methyloxolan-2-yl]pyrimidin-2-one?
The canonical SMILES for 4-amino-1-[(2R,5R)-5-methyloxolan-2-yl]pyrimidin-2-one is C[C@@H]1CC[C@H](n2ccc(N)nc2=O)O1.
What is the InChIKey of 4-amino-1-[(2R,5R)-5-methyloxolan-2-yl]pyrimidin-2-one?
The InChIKey is LUQDPHKLUKPHKK-HTRCEHHLSA-N. The full InChI is InChI=1S/C9H13N3O2/c1-6-2-3-8(14-6)12-5-4-7(10)11-9(12)13/h4-6,8H,2-3H2,1H3,(H2,10,11,13)/t6-,8-/m1/s1.
What are the key properties of 4-amino-1-[(2R,5R)-5-methyloxolan-2-yl]pyrimidin-2-one?
4-amino-1-[(2R,5R)-5-methyloxolan-2-yl]pyrimidin-2-one has a molecular weight of 195.22 g/mol, XLogP of 0.52, 1 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 4-amino-1-[(2R,5R)-5-methyloxolan-2-yl]pyrimidin-2-one is sourced from PubChem (CID 59859735), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).