C21H13N5O2 — CID 59860032
7-(4-pyridin-4-ylquinolin-6-yl)-1,4-dihydropyrido[2,3-b]pyrazine-2,3-dione (PubChem CID 59860032) has the molecular formula C21H13N5O2 and a molecular weight of 367.37 g/mol. Its IUPAC name is 7-(4-pyridin-4-ylquinolin-6-yl)-1,4-dihydropyrido[2,3-b]pyrazine-2,3-dione.
| Compound Name | 7-(4-pyridin-4-ylquinolin-6-yl)-1,4-dihydropyrido[2,3-b]pyrazine-2,3-dione |
|---|---|
| PubChem CID | 59860032 |
| Molecular Formula | C21H13N5O2 |
| Molecular Weight | 367.37 g/mol |
| Exact Mass | 367.11 |
| IUPAC Name | 7-(4-pyridin-4-ylquinolin-6-yl)-1,4-dihydropyrido[2,3-b]pyrazine-2,3-dione |
| SMILES | O=c1[nH]c2cc(-c3ccc4nccc(-c5ccncc5)c4c3)cnc2[nH]c1=O |
| InChI | InChI=1S/C21H13N5O2/c27-20-21(28)26-19-18(25-20)10-14(11-24-19)13-1-2-17-16(9-13)15(5-8-23-17)12-3-6-22-7-4-12/h1-11H,(H,25,27)(H,24,26,28) |
| InChIKey | SEVSIRDDERUCCY-UHFFFAOYSA-N |
| XLogP | 2.89 |
| TPSA | 104.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.37 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|