C22H16N4O — CID 59860102
6-(4-pyridin-4-ylquinolin-6-yl)-3,4-dihydro-1H-1,8-naphthyridin-2-one (PubChem CID 59860102) has the molecular formula C22H16N4O and a molecular weight of 352.40 g/mol. Its IUPAC name is 6-(4-pyridin-4-ylquinolin-6-yl)-3,4-dihydro-1H-1,8-naphthyridin-2-one.
| Compound Name | 6-(4-pyridin-4-ylquinolin-6-yl)-3,4-dihydro-1H-1,8-naphthyridin-2-one |
|---|---|
| PubChem CID | 59860102 |
| Molecular Formula | C22H16N4O |
| Molecular Weight | 352.40 g/mol |
| Exact Mass | 352.13 |
| IUPAC Name | 6-(4-pyridin-4-ylquinolin-6-yl)-3,4-dihydro-1H-1,8-naphthyridin-2-one |
| SMILES | O=C1CCc2cc(-c3ccc4nccc(-c5ccncc5)c4c3)cnc2N1 |
| InChI | InChI=1S/C22H16N4O/c27-21-4-2-16-11-17(13-25-22(16)26-21)15-1-3-20-19(12-15)18(7-10-24-20)14-5-8-23-9-6-14/h1,3,5-13H,2,4H2,(H,25,26,27) |
| InChIKey | SUVXGTPPPJAOBL-UHFFFAOYSA-N |
| XLogP | 4.24 |
| TPSA | 67.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.40 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |