About 1-cyano-N-(2,2-dimethylpropyl)cyclopropane-1-carboxamide
1-cyano-N-(2,2-dimethylpropyl)cyclopropane-1-carboxamide (PubChem CID 59860392) has the molecular formula C10H16N2O
and a molecular weight of 180.25 g/mol. Its IUPAC name is 1-cyano-N-(2,2-dimethylpropyl)cyclopropane-1-carboxamide.
Molecular Properties
| Compound Name | 1-cyano-N-(2,2-dimethylpropyl)cyclopropane-1-carboxamide |
| PubChem CID | 59860392 |
| Molecular Formula | C10H16N2O |
| Molecular Weight | 180.25 g/mol |
| Exact Mass | 180.13 |
| IUPAC Name | 1-cyano-N-(2,2-dimethylpropyl)cyclopropane-1-carboxamide |
| SMILES | CC(C)(C)CNC(=O)C1(C#N)CC1 |
| InChI | InChI=1S/C10H16N2O/c1-9(2,3)7-12-8(13)10(6-11)4-5-10/h4-5,7H2,1-3H3,(H,12,13) |
| InChIKey | KTDKLLSBVMUBFC-UHFFFAOYSA-N |
| XLogP | 1.45 |
| TPSA | 52.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 180.25 |
| LogP ≤ 5 | 1.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 1-cyano-N-(2,2-dimethylpropyl)cyclopropane-1-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-cyano-N-(2,2-dimethylpropyl)cyclopropane-1-carboxamide?
The IUPAC name of 1-cyano-N-(2,2-dimethylpropyl)cyclopropane-1-carboxamide (CID 59860392) is 1-cyano-N-(2,2-dimethylpropyl)cyclopropane-1-carboxamide.
What is the SMILES notation for 1-cyano-N-(2,2-dimethylpropyl)cyclopropane-1-carboxamide?
The canonical SMILES for 1-cyano-N-(2,2-dimethylpropyl)cyclopropane-1-carboxamide is CC(C)(C)CNC(=O)C1(C#N)CC1.
What is the InChIKey of 1-cyano-N-(2,2-dimethylpropyl)cyclopropane-1-carboxamide?
The InChIKey is KTDKLLSBVMUBFC-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H16N2O/c1-9(2,3)7-12-8(13)10(6-11)4-5-10/h4-5,7H2,1-3H3,(H,12,13).
What are the key properties of 1-cyano-N-(2,2-dimethylpropyl)cyclopropane-1-carboxamide?
1-cyano-N-(2,2-dimethylpropyl)cyclopropane-1-carboxamide has a molecular weight of 180.25 g/mol, XLogP of 1.45, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-cyano-N-(2,2-dimethylpropyl)cyclopropane-1-carboxamide is sourced from PubChem (CID 59860392), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).