About 1-isothiocyanato-4-methyl-2,3-dihydro-1H-indene
1-isothiocyanato-4-methyl-2,3-dihydro-1H-indene (PubChem CID 59860528) has the molecular formula C11H11NS
and a molecular weight of 189.28 g/mol. Its IUPAC name is 1-isothiocyanato-4-methyl-2,3-dihydro-1H-indene.
Molecular Properties
| Compound Name | 1-isothiocyanato-4-methyl-2,3-dihydro-1H-indene |
| PubChem CID | 59860528 |
| Molecular Formula | C11H11NS |
| Molecular Weight | 189.28 g/mol |
| Exact Mass | 189.06 |
| IUPAC Name | 1-isothiocyanato-4-methyl-2,3-dihydro-1H-indene |
| SMILES | Cc1cccc2c1CCC2N=C=S |
| InChI | InChI=1S/C11H11NS/c1-8-3-2-4-10-9(8)5-6-11(10)12-7-13/h2-4,11H,5-6H2,1H3 |
| InChIKey | YMZHYPZKEWFFJW-UHFFFAOYSA-N |
| XLogP | 3.09 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 189.28 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze 1-isothiocyanato-4-methyl-2,3-dihydro-1H-indene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-isothiocyanato-4-methyl-2,3-dihydro-1H-indene?
The IUPAC name of 1-isothiocyanato-4-methyl-2,3-dihydro-1H-indene (CID 59860528) is 1-isothiocyanato-4-methyl-2,3-dihydro-1H-indene.
What is the SMILES notation for 1-isothiocyanato-4-methyl-2,3-dihydro-1H-indene?
The canonical SMILES for 1-isothiocyanato-4-methyl-2,3-dihydro-1H-indene is Cc1cccc2c1CCC2N=C=S.
What is the InChIKey of 1-isothiocyanato-4-methyl-2,3-dihydro-1H-indene?
The InChIKey is YMZHYPZKEWFFJW-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H11NS/c1-8-3-2-4-10-9(8)5-6-11(10)12-7-13/h2-4,11H,5-6H2,1H3.
What are the key properties of 1-isothiocyanato-4-methyl-2,3-dihydro-1H-indene?
1-isothiocyanato-4-methyl-2,3-dihydro-1H-indene has a molecular weight of 189.28 g/mol, XLogP of 3.09, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-isothiocyanato-4-methyl-2,3-dihydro-1H-indene is sourced from PubChem (CID 59860528), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).