About 1-methyl-2,3-dihydroindene-1-carboxylic acid
1-methyl-2,3-dihydroindene-1-carboxylic acid (PubChem CID 59860531) has the molecular formula C11H12O2
and a molecular weight of 176.22 g/mol. Its IUPAC name is 1-methyl-2,3-dihydroindene-1-carboxylic acid.
Molecular Properties
| Compound Name | 1-methyl-2,3-dihydroindene-1-carboxylic acid |
| PubChem CID | 59860531 |
| Molecular Formula | C11H12O2 |
| Molecular Weight | 176.22 g/mol |
| Exact Mass | 176.08 |
| IUPAC Name | 1-methyl-2,3-dihydroindene-1-carboxylic acid |
| SMILES | CC1(C(=O)O)CCc2ccccc21 |
| InChI | InChI=1S/C11H12O2/c1-11(10(12)13)7-6-8-4-2-3-5-9(8)11/h2-5H,6-7H2,1H3,(H,12,13) |
| InChIKey | IJYVZCGPRUQYPX-UHFFFAOYSA-N |
| XLogP | 1.98 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 176.22 |
| LogP ≤ 5 | 1.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 1-methyl-2,3-dihydroindene-1-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-methyl-2,3-dihydroindene-1-carboxylic acid?
The IUPAC name of 1-methyl-2,3-dihydroindene-1-carboxylic acid (CID 59860531) is 1-methyl-2,3-dihydroindene-1-carboxylic acid.
What is the SMILES notation for 1-methyl-2,3-dihydroindene-1-carboxylic acid?
The canonical SMILES for 1-methyl-2,3-dihydroindene-1-carboxylic acid is CC1(C(=O)O)CCc2ccccc21.
What is the InChIKey of 1-methyl-2,3-dihydroindene-1-carboxylic acid?
The InChIKey is IJYVZCGPRUQYPX-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H12O2/c1-11(10(12)13)7-6-8-4-2-3-5-9(8)11/h2-5H,6-7H2,1H3,(H,12,13).
What are the key properties of 1-methyl-2,3-dihydroindene-1-carboxylic acid?
1-methyl-2,3-dihydroindene-1-carboxylic acid has a molecular weight of 176.22 g/mol, XLogP of 1.98, 1 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1-methyl-2,3-dihydroindene-1-carboxylic acid is sourced from PubChem (CID 59860531), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).