C16H18N4 — CID 59861037
6-methyl-2-(4-methylphenyl)-1,2,3,5,6,7-hexahydroimidazo[4,5-f]benzimidazole (PubChem CID 59861037) has the molecular formula C16H18N4 and a molecular weight of 266.35 g/mol. Its IUPAC name is 6-methyl-2-(4-methylphenyl)-1,2,3,5,6,7-hexahydroimidazo[4,5-f]benzimidazole.
| Compound Name | 6-methyl-2-(4-methylphenyl)-1,2,3,5,6,7-hexahydroimidazo[4,5-f]benzimidazole |
|---|---|
| PubChem CID | 59861037 |
| Molecular Formula | C16H18N4 |
| Molecular Weight | 266.35 g/mol |
| Exact Mass | 266.15 |
| IUPAC Name | 6-methyl-2-(4-methylphenyl)-1,2,3,5,6,7-hexahydroimidazo[4,5-f]benzimidazole |
| SMILES | Cc1ccc(C2Nc3cc4c(cc3N2)NC(C)N4)cc1 |
| InChI | InChI=1S/C16H18N4/c1-9-3-5-11(6-4-9)16-19-14-7-12-13(8-15(14)20-16)18-10(2)17-12/h3-8,10,16-20H,1-2H3 |
| InChIKey | CPTVXNSGNIJZLS-UHFFFAOYSA-N |
| XLogP | 3.71 |
| TPSA | 48.12 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.35 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |