C5H3F5 — CID 59861111
(3E)-1,1,2,3,4-pentafluoropenta-1,3-diene (PubChem CID 59861111) has the molecular formula C5H3F5 and a molecular weight of 158.07 g/mol. Its IUPAC name is (3E)-1,1,2,3,4-pentafluoropenta-1,3-diene.
| Compound Name | (3E)-1,1,2,3,4-pentafluoropenta-1,3-diene |
|---|---|
| PubChem CID | 59861111 |
| Molecular Formula | C5H3F5 |
| Molecular Weight | 158.07 g/mol |
| Exact Mass | 158.02 |
| IUPAC Name | (3E)-1,1,2,3,4-pentafluoropenta-1,3-diene |
| SMILES | C/C(F)=C(\F)C(F)=C(F)F |
| InChI | InChI=1S/C5H3F5/c1-2(6)3(7)4(8)5(9)10/h1H3/b3-2+ |
| InChIKey | VPQYGJPYDMEEIA-NSCUHMNNSA-N |
| XLogP | 3.23 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 158.07 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|