C26H32O5S — CID 59861601
[6-(1,3-dioxolan-2-yl)-3-(2-phenylethyl)octa-1,7-dien-4-yl] 4-methylbenzenesulfonate (PubChem CID 59861601) has the molecular formula C26H32O5S and a molecular weight of 456.60 g/mol. Its IUPAC name is [6-(1,3-dioxolan-2-yl)-3-(2-phenylethyl)octa-1,7-dien-4-yl] 4-methylbenzenesulfonate.
| Compound Name | [6-(1,3-dioxolan-2-yl)-3-(2-phenylethyl)octa-1,7-dien-4-yl] 4-methylbenzenesulfonate |
|---|---|
| PubChem CID | 59861601 |
| Molecular Formula | C26H32O5S |
| Molecular Weight | 456.60 g/mol |
| Exact Mass | 456.20 |
| IUPAC Name | [6-(1,3-dioxolan-2-yl)-3-(2-phenylethyl)octa-1,7-dien-4-yl] 4-methylbenzenesulfonate |
| SMILES | C=CC(CCc1ccccc1)C(CC(C=C)C1OCCO1)OS(=O)(=O)c1ccc(C)cc1 |
| InChI | InChI=1S/C26H32O5S/c1-4-22(14-13-21-9-7-6-8-10-21)25(19-23(5-2)26-29-17-18-30-26)31-32(27,28)24-15-11-20(3)12-16-24/h4-12,15-16,22-23,25-26H,1-2,13-14,17-19H2,3H3 |
| InChIKey | MHZUNAUYPBCIAL-UHFFFAOYSA-N |
| XLogP | 5.07 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.60 |
| LogP ≤ 5 | 5.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|