About 6-benzylidene-2,2-dimethylcyclohexan-1-one
6-benzylidene-2,2-dimethylcyclohexan-1-one (PubChem CID 598624) has the molecular formula C15H18O
and a molecular weight of 214.31 g/mol. Its IUPAC name is 6-benzylidene-2,2-dimethylcyclohexan-1-one.
Molecular Properties
| Compound Name | 6-benzylidene-2,2-dimethylcyclohexan-1-one |
| PubChem CID | 598624 |
| Molecular Formula | C15H18O |
| Molecular Weight | 214.31 g/mol |
| Exact Mass | 214.14 |
| IUPAC Name | 6-benzylidene-2,2-dimethylcyclohexan-1-one |
| SMILES | CC1(C)CCCC(=Cc2ccccc2)C1=O |
| InChI | InChI=1S/C15H18O/c1-15(2)10-6-9-13(14(15)16)11-12-7-4-3-5-8-12/h3-5,7-8,11H,6,9-10H2,1-2H3 |
| InChIKey | USWYHRHBCQIVDR-UHFFFAOYSA-N |
| XLogP | 3.85 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 214.31 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze 6-benzylidene-2,2-dimethylcyclohexan-1-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-benzylidene-2,2-dimethylcyclohexan-1-one?
The IUPAC name of 6-benzylidene-2,2-dimethylcyclohexan-1-one (CID 598624) is 6-benzylidene-2,2-dimethylcyclohexan-1-one.
What is the SMILES notation for 6-benzylidene-2,2-dimethylcyclohexan-1-one?
The canonical SMILES for 6-benzylidene-2,2-dimethylcyclohexan-1-one is CC1(C)CCCC(=Cc2ccccc2)C1=O.
What is the InChIKey of 6-benzylidene-2,2-dimethylcyclohexan-1-one?
The InChIKey is USWYHRHBCQIVDR-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H18O/c1-15(2)10-6-9-13(14(15)16)11-12-7-4-3-5-8-12/h3-5,7-8,11H,6,9-10H2,1-2H3.
What are the key properties of 6-benzylidene-2,2-dimethylcyclohexan-1-one?
6-benzylidene-2,2-dimethylcyclohexan-1-one has a molecular weight of 214.31 g/mol, XLogP of 3.85, 1 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 6-benzylidene-2,2-dimethylcyclohexan-1-one is sourced from PubChem (CID 598624), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).