About 4-chlorotricyclo[5.2.1.02,6]decan-3-ol
4-chlorotricyclo[5.2.1.02,6]decan-3-ol (PubChem CID 59863169) has the molecular formula C10H15ClO
and a molecular weight of 186.68 g/mol. Its IUPAC name is 4-chlorotricyclo[5.2.1.02,6]decan-3-ol.
Molecular Properties
| Compound Name | 4-chlorotricyclo[5.2.1.02,6]decan-3-ol |
| PubChem CID | 59863169 |
| Molecular Formula | C10H15ClO |
| Molecular Weight | 186.68 g/mol |
| Exact Mass | 186.08 |
| IUPAC Name | 4-chlorotricyclo[5.2.1.02,6]decan-3-ol |
| SMILES | OC1C(Cl)CC2C3CCC(C3)C12 |
| InChI | InChI=1S/C10H15ClO/c11-8-4-7-5-1-2-6(3-5)9(7)10(8)12/h5-10,12H,1-4H2 |
| InChIKey | JBNYUSZFCWNFPX-UHFFFAOYSA-N |
| XLogP | 2.02 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 186.68 |
| LogP ≤ 5 | 2.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze 4-chlorotricyclo[5.2.1.02,6]decan-3-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-chlorotricyclo[5.2.1.02,6]decan-3-ol?
The IUPAC name of 4-chlorotricyclo[5.2.1.02,6]decan-3-ol (CID 59863169) is 4-chlorotricyclo[5.2.1.02,6]decan-3-ol.
What is the SMILES notation for 4-chlorotricyclo[5.2.1.02,6]decan-3-ol?
The canonical SMILES for 4-chlorotricyclo[5.2.1.02,6]decan-3-ol is OC1C(Cl)CC2C3CCC(C3)C12.
What is the InChIKey of 4-chlorotricyclo[5.2.1.02,6]decan-3-ol?
The InChIKey is JBNYUSZFCWNFPX-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H15ClO/c11-8-4-7-5-1-2-6(3-5)9(7)10(8)12/h5-10,12H,1-4H2.
What are the key properties of 4-chlorotricyclo[5.2.1.02,6]decan-3-ol?
4-chlorotricyclo[5.2.1.02,6]decan-3-ol has a molecular weight of 186.68 g/mol, XLogP of 2.02, 0 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 4-chlorotricyclo[5.2.1.02,6]decan-3-ol is sourced from PubChem (CID 59863169), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).