About 3-[4-(3,5-ditert-butylphenyl)-6-naphthalen-2-yl-2-pyridinyl]isoquinoline
3-[4-(3,5-ditert-butylphenyl)-6-naphthalen-2-yl-2-pyridinyl]isoquinoline (PubChem CID 59863406) has the molecular formula C38H36N2
and a molecular weight of 520.72 g/mol. Its IUPAC name is 3-[4-(3,5-ditert-butylphenyl)-6-naphthalen-2-yl-2-pyridinyl]isoquinoline.
Molecular Properties
| Compound Name | 3-[4-(3,5-ditert-butylphenyl)-6-naphthalen-2-yl-2-pyridinyl]isoquinoline |
| PubChem CID | 59863406 |
| Molecular Formula | C38H36N2 |
| Molecular Weight | 520.72 g/mol |
| Exact Mass | 520.29 |
| IUPAC Name | 3-[4-(3,5-ditert-butylphenyl)-6-naphthalen-2-yl-2-pyridinyl]isoquinoline |
| SMILES | CC(C)(C)c1cc(-c2cc(-c3ccc4ccccc4c3)nc(-c3cc4ccccc4cn3)c2)cc(C(C)(C)C)c1 |
| InChI | InChI=1S/C38H36N2/c1-37(2,3)32-18-30(19-33(23-32)38(4,5)6)31-21-34(28-16-15-25-11-7-8-12-26(25)17-28)40-36(22-31)35-20-27-13-9-10-14-29(27)24-39-35/h7-24H,1-6H3 |
| InChIKey | YUNKJBJRMNXGPW-UHFFFAOYSA-N |
| XLogP | 10.38 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 40 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 520.72 |
| LogP ≤ 5 | 10.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 3-[4-(3,5-ditert-butylphenyl)-6-naphthalen-2-yl-2-pyridinyl]isoquinoline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[4-(3,5-ditert-butylphenyl)-6-naphthalen-2-yl-2-pyridinyl]isoquinoline?
The IUPAC name of 3-[4-(3,5-ditert-butylphenyl)-6-naphthalen-2-yl-2-pyridinyl]isoquinoline (CID 59863406) is 3-[4-(3,5-ditert-butylphenyl)-6-naphthalen-2-yl-2-pyridinyl]isoquinoline.
What is the SMILES notation for 3-[4-(3,5-ditert-butylphenyl)-6-naphthalen-2-yl-2-pyridinyl]isoquinoline?
The canonical SMILES for 3-[4-(3,5-ditert-butylphenyl)-6-naphthalen-2-yl-2-pyridinyl]isoquinoline is CC(C)(C)c1cc(-c2cc(-c3ccc4ccccc4c3)nc(-c3cc4ccccc4cn3)c2)cc(C(C)(C)C)c1.
What is the InChIKey of 3-[4-(3,5-ditert-butylphenyl)-6-naphthalen-2-yl-2-pyridinyl]isoquinoline?
The InChIKey is YUNKJBJRMNXGPW-UHFFFAOYSA-N. The full InChI is InChI=1S/C38H36N2/c1-37(2,3)32-18-30(19-33(23-32)38(4,5)6)31-21-34(28-16-15-25-11-7-8-12-26(25)17-28)40-36(22-31)35-20-27-13-9-10-14-29(27)24-39-35/h7-24H,1-6H3.
What are the key properties of 3-[4-(3,5-ditert-butylphenyl)-6-naphthalen-2-yl-2-pyridinyl]isoquinoline?
3-[4-(3,5-ditert-butylphenyl)-6-naphthalen-2-yl-2-pyridinyl]isoquinoline has a molecular weight of 520.72 g/mol, XLogP of 10.38, 3 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[4-(3,5-ditert-butylphenyl)-6-naphthalen-2-yl-2-pyridinyl]isoquinoline is sourced from PubChem (CID 59863406), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).