C32H17ClF6N2Pt — CID 59863407
3-[4-[3,5-bis(trifluoromethyl)phenyl]-6-(3H-naphthalen-3-id-2-yl)-2-pyridinyl]isoquinoline;chloroplatinum(1+) (PubChem CID 59863407) has the molecular formula C32H17ClF6N2Pt and a molecular weight of 774.02 g/mol. Its IUPAC name is 3-[4-[3,5-bis(trifluoromethyl)phenyl]-6-(3H-naphthalen-3-id-2-yl)-2-pyridinyl]isoquinoline;chloroplatinum(1+).
| Compound Name | 3-[4-[3,5-bis(trifluoromethyl)phenyl]-6-(3H-naphthalen-3-id-2-yl)-2-pyridinyl]isoquinoline;chloroplatinum(1+) |
|---|---|
| PubChem CID | 59863407 |
| Molecular Formula | C32H17ClF6N2Pt |
| Molecular Weight | 774.02 g/mol |
| Exact Mass | 773.06 |
| IUPAC Name | 3-[4-[3,5-bis(trifluoromethyl)phenyl]-6-(3H-naphthalen-3-id-2-yl)-2-pyridinyl]isoquinoline;chloroplatinum(1+) |
| SMILES | Cl[Pt+].FC(F)(F)c1cc(-c2cc(-c3[c-]cc4ccccc4c3)nc(-c3cc4ccccc4cn3)c2)cc(C(F)(F)F)c1 |
| InChI | InChI=1S/C32H17F6N2.ClH.Pt/c33-31(34,35)26-12-24(13-27(17-26)32(36,37)38)25-15-28(22-10-9-19-5-1-2-6-20(19)11-22)40-30(16-25)29-14-21-7-3-4-8-23(21)18-39-29;;/h1-9,11-18H;1H;/q-1;;+2/p-1 |
| InChIKey | UWPNPRNJJFAODM-UHFFFAOYSA-M |
| XLogP | 10.31 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 774.02 |
| LogP ≤ 5 | 10.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|