C52H68FeN18O4 — CID 59863538
bis(ethyl 5-[(3-tert-butyl-8-heptan-3-yl-1,2,7-triaza-6-azanidabicyclo[3.3.0]octa-2,4,7-trien-4-yl)diazenyl]-1-pyridin-2-ylpyrazole-4-carboxylate);iron(2+) (PubChem CID 59863538) has the molecular formula C52H68FeN18O4 and a molecular weight of 1065.08 g/mol. Its IUPAC name is bis(ethyl 5-[(3-tert-butyl-8-heptan-3-yl-1,2,7-triaza-6-azanidabicyclo[3.3.0]octa-2,4,7-trien-4-yl)diazenyl]-1-pyridin-2-ylpyrazole-4-carboxylate);iron(2+).
| Compound Name | bis(ethyl 5-[(3-tert-butyl-8-heptan-3-yl-1,2,7-triaza-6-azanidabicyclo[3.3.0]octa-2,4,7-trien-4-yl)diazenyl]-1-pyridin-2-ylpyrazole-4-carboxylate);iron(2+) |
|---|---|
| PubChem CID | 59863538 |
| Molecular Formula | C52H68FeN18O4 |
| Molecular Weight | 1065.08 g/mol |
| Exact Mass | 1064.50 |
| IUPAC Name | bis(ethyl 5-[(3-tert-butyl-8-heptan-3-yl-1,2,7-triaza-6-azanidabicyclo[3.3.0]octa-2,4,7-trien-4-yl)diazenyl]-1-pyridin-2-ylpyrazole-4-carboxylate);iron(2+) |
| SMILES | CCCCC(CC)c1n[n-]c2c(/N=N/c3c(C(=O)OCC)cnn3-c3ccccn3)c(C(C)(C)C)nn12.CCCCC(CC)c1n[n-]c2c(/N=N/c3c(C(=O)OCC)cnn3-c3ccccn3)c(C(C)(C)C)nn12.[Fe+2] |
| InChI | InChI=1S/2C26H35N9O2.Fe/c2*1-7-10-13-17(8-2)22-30-32-24-20(21(26(4,5)6)33-35(22)24)29-31-23-18(25(36)37-9-3)16-28-34(23)19-14-11-12-15-27-19;/h2*11-12,14-17H,7-10,13H2,1-6H3,(H,28,31,32,33,36);/q;;+2/p-2 |
| InChIKey | UXQYUOHRMBCYIO-UHFFFAOYSA-L |
| XLogP | 11.68 |
| TPSA | 252.04 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 20 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 75 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1065.08 |
| LogP ≤ 5 | 11.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 20 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|