C33H43NO18 — CID 59863604
[5-acetamido-4-acetyloxy-6-(4-methoxyphenoxy)-3-[3,4,5-triacetyloxy-6-(acetyloxymethyl)oxan-2-yl]oxyoxan-2-yl]methyl acetate (PubChem CID 59863604) has the molecular formula C33H43NO18 and a molecular weight of 741.70 g/mol. Its IUPAC name is [5-acetamido-4-acetyloxy-6-(4-methoxyphenoxy)-3-[3,4,5-triacetyloxy-6-(acetyloxymethyl)oxan-2-yl]oxyoxan-2-yl]methyl acetate.
| Compound Name | [5-acetamido-4-acetyloxy-6-(4-methoxyphenoxy)-3-[3,4,5-triacetyloxy-6-(acetyloxymethyl)oxan-2-yl]oxyoxan-2-yl]methyl acetate |
|---|---|
| PubChem CID | 59863604 |
| Molecular Formula | C33H43NO18 |
| Molecular Weight | 741.70 g/mol |
| Exact Mass | 741.25 |
| IUPAC Name | [5-acetamido-4-acetyloxy-6-(4-methoxyphenoxy)-3-[3,4,5-triacetyloxy-6-(acetyloxymethyl)oxan-2-yl]oxyoxan-2-yl]methyl acetate |
| SMILES | COc1ccc(OC2OC(COC(C)=O)C(OC3OC(COC(C)=O)C(OC(C)=O)C(OC(C)=O)C3OC(C)=O)C(OC(C)=O)C2NC(C)=O)cc1 |
| InChI | InChI=1S/C33H43NO18/c1-15(35)34-26-29(46-19(5)39)27(24(13-43-16(2)36)50-32(26)49-23-11-9-22(42-8)10-12-23)52-33-31(48-21(7)41)30(47-20(6)40)28(45-18(4)38)25(51-33)14-44-17(3)37/h9-12,24-33H,13-14H2,1-8H3,(H,34,35) |
| InChIKey | NTEOBDSBPLIRHB-UHFFFAOYSA-N |
| XLogP | 0.27 |
| TPSA | 233.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 18 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 741.70 |
| LogP ≤ 5 | 0.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 18 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|