C10H18N2S — CID 59863941
(3aS,6aR)-4-tert-butyl-2-methylidene-1,3,3a,4,6,6a-hexahydrothieno[3,4-d]imidazole (PubChem CID 59863941) has the molecular formula C10H18N2S and a molecular weight of 198.33 g/mol. Its IUPAC name is (3aS,6aR)-4-tert-butyl-2-methylidene-1,3,3a,4,6,6a-hexahydrothieno[3,4-d]imidazole.
| Compound Name | (3aS,6aR)-4-tert-butyl-2-methylidene-1,3,3a,4,6,6a-hexahydrothieno[3,4-d]imidazole |
|---|---|
| PubChem CID | 59863941 |
| Molecular Formula | C10H18N2S |
| Molecular Weight | 198.33 g/mol |
| Exact Mass | 198.12 |
| IUPAC Name | (3aS,6aR)-4-tert-butyl-2-methylidene-1,3,3a,4,6,6a-hexahydrothieno[3,4-d]imidazole |
| SMILES | C=C1N[C@H]2CSC(C(C)(C)C)[C@H]2N1 |
| InChI | InChI=1S/C10H18N2S/c1-6-11-7-5-13-9(8(7)12-6)10(2,3)4/h7-9,11-12H,1,5H2,2-4H3/t7-,8-,9?/m0/s1 |
| InChIKey | MSTXBFHIOMZVFS-JVIMKECRSA-N |
| XLogP | 1.55 |
| TPSA | 24.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 198.33 |
| LogP ≤ 5 | 1.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |