C11H19NS — CID 59863945
(3aR,6aS)-6-tert-butyl-2-methylidene-1,3,3a,4,6,6a-hexahydrothieno[3,4-b]pyrrole (PubChem CID 59863945) has the molecular formula C11H19NS and a molecular weight of 197.35 g/mol. Its IUPAC name is (3aR,6aS)-6-tert-butyl-2-methylidene-1,3,3a,4,6,6a-hexahydrothieno[3,4-b]pyrrole.
| Compound Name | (3aR,6aS)-6-tert-butyl-2-methylidene-1,3,3a,4,6,6a-hexahydrothieno[3,4-b]pyrrole |
|---|---|
| PubChem CID | 59863945 |
| Molecular Formula | C11H19NS |
| Molecular Weight | 197.35 g/mol |
| Exact Mass | 197.12 |
| IUPAC Name | (3aR,6aS)-6-tert-butyl-2-methylidene-1,3,3a,4,6,6a-hexahydrothieno[3,4-b]pyrrole |
| SMILES | C=C1C[C@H]2CSC(C(C)(C)C)[C@H]2N1 |
| InChI | InChI=1S/C11H19NS/c1-7-5-8-6-13-10(9(8)12-7)11(2,3)4/h8-10,12H,1,5-6H2,2-4H3/t8-,9-,10?/m0/s1 |
| InChIKey | IUQREWZYCVBACA-XMCUXHSSSA-N |
| XLogP | 2.64 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 197.35 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |