About propane;propan-2-yliminomethylidenenickel
propane;propan-2-yliminomethylidenenickel (PubChem CID 59863975) has the molecular formula C7H14NNi-
and a molecular weight of 170.89 g/mol. Its IUPAC name is propane;propan-2-yliminomethylidenenickel.
Molecular Properties
| Compound Name | propane;propan-2-yliminomethylidenenickel |
| PubChem CID | 59863975 |
| Molecular Formula | C7H14NNi- |
| Molecular Weight | 170.89 g/mol |
| Exact Mass | 170.05 |
| IUPAC Name | propane;propan-2-yliminomethylidenenickel |
| SMILES | CC(C)N=C=[Ni].[CH2-]CC |
| InChI | InChI=1S/C4H7N.C3H7.Ni/c1-4(2)5-3;1-3-2;/h4H,1-2H3;1,3H2,2H3;/q;-1; |
| InChIKey | JCMOFAKNQYKQAZ-UHFFFAOYSA-N |
| XLogP | 2.08 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 170.89 |
| LogP ≤ 5 | 2.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze propane;propan-2-yliminomethylidenenickel with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of propane;propan-2-yliminomethylidenenickel?
The IUPAC name of propane;propan-2-yliminomethylidenenickel (CID 59863975) is propane;propan-2-yliminomethylidenenickel.
What is the SMILES notation for propane;propan-2-yliminomethylidenenickel?
The canonical SMILES for propane;propan-2-yliminomethylidenenickel is CC(C)N=C=[Ni].[CH2-]CC.
What is the InChIKey of propane;propan-2-yliminomethylidenenickel?
The InChIKey is JCMOFAKNQYKQAZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H7N.C3H7.Ni/c1-4(2)5-3;1-3-2;/h4H,1-2H3;1,3H2,2H3;/q;-1;.
What are the key properties of propane;propan-2-yliminomethylidenenickel?
propane;propan-2-yliminomethylidenenickel has a molecular weight of 170.89 g/mol, XLogP of 2.08, 1 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for propane;propan-2-yliminomethylidenenickel is sourced from PubChem (CID 59863975), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).