About 2-(2,5-dioxo-1,4-diazecan-7-yl)acetamide
2-(2,5-dioxo-1,4-diazecan-7-yl)acetamide (PubChem CID 59864061) has the molecular formula C10H17N3O3
and a molecular weight of 227.26 g/mol. Its IUPAC name is 2-(2,5-dioxo-1,4-diazecan-7-yl)acetamide.
Molecular Properties
| Compound Name | 2-(2,5-dioxo-1,4-diazecan-7-yl)acetamide |
| PubChem CID | 59864061 |
| Molecular Formula | C10H17N3O3 |
| Molecular Weight | 227.26 g/mol |
| Exact Mass | 227.13 |
| IUPAC Name | 2-(2,5-dioxo-1,4-diazecan-7-yl)acetamide |
| SMILES | NC(=O)CC1CCCNC(=O)CNC(=O)C1 |
| InChI | InChI=1S/C10H17N3O3/c11-8(14)4-7-2-1-3-12-10(16)6-13-9(15)5-7/h7H,1-6H2,(H2,11,14)(H,12,16)(H,13,15) |
| InChIKey | HIMDIPWFRSWLAE-UHFFFAOYSA-N |
| XLogP | -1.11 |
| TPSA | 101.29 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 227.26 |
| LogP ≤ 5 | -1.11 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2-(2,5-dioxo-1,4-diazecan-7-yl)acetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(2,5-dioxo-1,4-diazecan-7-yl)acetamide?
The IUPAC name of 2-(2,5-dioxo-1,4-diazecan-7-yl)acetamide (CID 59864061) is 2-(2,5-dioxo-1,4-diazecan-7-yl)acetamide.
What is the SMILES notation for 2-(2,5-dioxo-1,4-diazecan-7-yl)acetamide?
The canonical SMILES for 2-(2,5-dioxo-1,4-diazecan-7-yl)acetamide is NC(=O)CC1CCCNC(=O)CNC(=O)C1.
What is the InChIKey of 2-(2,5-dioxo-1,4-diazecan-7-yl)acetamide?
The InChIKey is HIMDIPWFRSWLAE-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H17N3O3/c11-8(14)4-7-2-1-3-12-10(16)6-13-9(15)5-7/h7H,1-6H2,(H2,11,14)(H,12,16)(H,13,15).
What are the key properties of 2-(2,5-dioxo-1,4-diazecan-7-yl)acetamide?
2-(2,5-dioxo-1,4-diazecan-7-yl)acetamide has a molecular weight of 227.26 g/mol, XLogP of -1.11, 2 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(2,5-dioxo-1,4-diazecan-7-yl)acetamide is sourced from PubChem (CID 59864061), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).