C18H33NO — CID 59864258
1,5,6-tritert-butyl-3,4-dihydro-2H-azepin-7-one (PubChem CID 59864258) has the molecular formula C18H33NO and a molecular weight of 279.47 g/mol. Its IUPAC name is 1,5,6-tritert-butyl-3,4-dihydro-2H-azepin-7-one.
| Compound Name | 1,5,6-tritert-butyl-3,4-dihydro-2H-azepin-7-one |
|---|---|
| PubChem CID | 59864258 |
| Molecular Formula | C18H33NO |
| Molecular Weight | 279.47 g/mol |
| Exact Mass | 279.26 |
| IUPAC Name | 1,5,6-tritert-butyl-3,4-dihydro-2H-azepin-7-one |
| SMILES | CC(C)(C)C1=C(C(C)(C)C)C(=O)N(C(C)(C)C)CCC1 |
| InChI | InChI=1S/C18H33NO/c1-16(2,3)13-11-10-12-19(18(7,8)9)15(20)14(13)17(4,5)6/h10-12H2,1-9H3 |
| InChIKey | NIMXLIRPFSWTHD-UHFFFAOYSA-N |
| XLogP | 4.80 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.47 |
| LogP ≤ 5 | 4.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |